C22H21N3O3 — CID 130320453
N-[(Z)-3-(1,3-dihydroisoindol-2-yl)-2-hydroxyprop-1-enyl]-2-quinolin-8-yloxyacetamide (PubChem CID 130320453) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is N-[(Z)-3-(1,3-dihydroisoindol-2-yl)-2-hydroxyprop-1-enyl]-2-quinolin-8-yloxyacetamide.
| Compound Name | N-[(Z)-3-(1,3-dihydroisoindol-2-yl)-2-hydroxyprop-1-enyl]-2-quinolin-8-yloxyacetamide |
|---|---|
| PubChem CID | 130320453 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[(Z)-3-(1,3-dihydroisoindol-2-yl)-2-hydroxyprop-1-enyl]-2-quinolin-8-yloxyacetamide |
| SMILES | O=C(COc1cccc2cccnc12)N/C=C(\O)CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C22H21N3O3/c26-19(14-25-12-17-5-1-2-6-18(17)13-25)11-24-21(27)15-28-20-9-3-7-16-8-4-10-23-22(16)20/h1-11,26H,12-15H2,(H,24,27)/b19-11- |
| InChIKey | JQXJARLVHZYNKD-ODLFYWEKSA-N |
| XLogP | 3.14 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|