About N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide
N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide (PubChem CID 130320463) has the molecular formula C13H15FN6O3S
and a molecular weight of 354.37 g/mol. Its IUPAC name is N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide |
| PubChem CID | 130320463 |
| Molecular Formula | C13H15FN6O3S |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide |
| SMILES | CNc1cc(NC(C)=O)nc(Sc2c(OC)nc(F)nc2OC)n1 |
| InChI | InChI=1S/C13H15FN6O3S/c1-6(21)16-8-5-7(15-2)17-13(18-8)24-9-10(22-3)19-12(14)20-11(9)23-4/h5H,1-4H3,(H2,15,16,17,18,21) |
| InChIKey | VHZHXPVRRIEBSO-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 111.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide?
The IUPAC name of N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide (CID 130320463) is N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide.
What is the SMILES notation for N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide?
The canonical SMILES for N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide is CNc1cc(NC(C)=O)nc(Sc2c(OC)nc(F)nc2OC)n1.
What is the InChIKey of N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide?
The InChIKey is VHZHXPVRRIEBSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN6O3S/c1-6(21)16-8-5-7(15-2)17-13(18-8)24-9-10(22-3)19-12(14)20-11(9)23-4/h5H,1-4H3,(H2,15,16,17,18,21).
What are the key properties of N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide?
N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide has a molecular weight of 354.37 g/mol, XLogP of 1.57, 6 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(2-fluoro-4,6-dimethoxypyrimidin-5-yl)sulfanyl-6-(methylamino)pyrimidin-4-yl]acetamide is sourced from PubChem (CID 130320463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).