C21H28N2O2 — CID 130320482
(2E,3Z)-N-[3-[(4Z,6Z)-3,8-dimethylidene-2,9-dihydroazonin-1-yl]-2-hydroxypropyl]-2-ethylidenehexa-3,5-dienamide (PubChem CID 130320482) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (2E,3Z)-N-[3-[(4Z,6Z)-3,8-dimethylidene-2,9-dihydroazonin-1-yl]-2-hydroxypropyl]-2-ethylidenehexa-3,5-dienamide.
| Compound Name | (2E,3Z)-N-[3-[(4Z,6Z)-3,8-dimethylidene-2,9-dihydroazonin-1-yl]-2-hydroxypropyl]-2-ethylidenehexa-3,5-dienamide |
|---|---|
| PubChem CID | 130320482 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (2E,3Z)-N-[3-[(4Z,6Z)-3,8-dimethylidene-2,9-dihydroazonin-1-yl]-2-hydroxypropyl]-2-ethylidenehexa-3,5-dienamide |
| SMILES | C=C/C=C\C(=C/C)C(=O)NCC(O)CN1CC(=C)/C=C\C=C/C(=C)C1 |
| InChI | InChI=1S/C21H28N2O2/c1-5-7-12-19(6-2)21(25)22-13-20(24)16-23-14-17(3)10-8-9-11-18(4)15-23/h5-12,20,24H,1,3-4,13-16H2,2H3,(H,22,25)/b10-8-,11-9-,12-7-,19-6+ |
| InChIKey | FGZSPZQBUMGGMA-KNQNAELVSA-N |
| XLogP | 2.69 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|