About 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine
1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine (PubChem CID 130320508) has the molecular formula C6H12N4
and a molecular weight of 140.19 g/mol. Its IUPAC name is 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine.
Molecular Properties
| Compound Name | 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine |
| PubChem CID | 130320508 |
| Molecular Formula | C6H12N4 |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.11 |
| IUPAC Name | 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine |
| SMILES | [H]/N=C(\N)N(N)/C=C\C=C/C |
| InChI | InChI=1S/C6H12N4/c1-2-3-4-5-10(9)6(7)8/h2-5H,9H2,1H3,(H3,7,8)/b3-2-,5-4- |
| InChIKey | IJQXSEHESSJAPW-LDIADDGTSA-N |
| XLogP | 0.15 |
| TPSA | 79.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine?
The IUPAC name of 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine (CID 130320508) is 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine.
What is the SMILES notation for 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine?
The canonical SMILES for 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine is [H]/N=C(\N)N(N)/C=C\C=C/C.
What is the InChIKey of 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine?
The InChIKey is IJQXSEHESSJAPW-LDIADDGTSA-N. The full InChI is InChI=1S/C6H12N4/c1-2-3-4-5-10(9)6(7)8/h2-5H,9H2,1H3,(H3,7,8)/b3-2-,5-4-.
What are the key properties of 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine?
1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine has a molecular weight of 140.19 g/mol, XLogP of 0.15, 2 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1-[(1Z,3Z)-penta-1,3-dienyl]guanidine is sourced from PubChem (CID 130320508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).