C24H39ClO2 — CID 130320716
3-[(3E,7E)-15-chloropentadeca-3,7-dienoxy]-2,6,6-trimethylcyclohex-2-en-1-one (PubChem CID 130320716) has the molecular formula C24H39ClO2 and a molecular weight of 395.03 g/mol. Its IUPAC name is 3-[(3E,7E)-15-chloropentadeca-3,7-dienoxy]-2,6,6-trimethylcyclohex-2-en-1-one.
| Compound Name | 3-[(3E,7E)-15-chloropentadeca-3,7-dienoxy]-2,6,6-trimethylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 130320716 |
| Molecular Formula | C24H39ClO2 |
| Molecular Weight | 395.03 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | 3-[(3E,7E)-15-chloropentadeca-3,7-dienoxy]-2,6,6-trimethylcyclohex-2-en-1-one |
| SMILES | CC1=C(OCC/C=C/CC/C=C/CCCCCCCCl)CCC(C)(C)C1=O |
| InChI | InChI=1S/C24H39ClO2/c1-21-22(17-18-24(2,3)23(21)26)27-20-16-14-12-10-8-6-4-5-7-9-11-13-15-19-25/h4,6,12,14H,5,7-11,13,15-20H2,1-3H3/b6-4+,14-12+ |
| InChIKey | IKHYIVBPAULSHI-LZUOLKHISA-N |
| XLogP | 7.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.03 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|