C19H30F2N4 — CID 130321334
(Z)-1-N-(4-fluoro-5-methylcyclohexa-1,5-dien-1-yl)-5-[[(Z)-2-fluoro-3-(propylamino)but-2-enylidene]amino]pent-1-ene-1,2-diamine (PubChem CID 130321334) has the molecular formula C19H30F2N4 and a molecular weight of 352.47 g/mol. Its IUPAC name is (Z)-1-N-(4-fluoro-5-methylcyclohexa-1,5-dien-1-yl)-5-[[(Z)-2-fluoro-3-(propylamino)but-2-enylidene]amino]pent-1-ene-1,2-diamine.
| Compound Name | (Z)-1-N-(4-fluoro-5-methylcyclohexa-1,5-dien-1-yl)-5-[[(Z)-2-fluoro-3-(propylamino)but-2-enylidene]amino]pent-1-ene-1,2-diamine |
|---|---|
| PubChem CID | 130321334 |
| Molecular Formula | C19H30F2N4 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.24 |
| IUPAC Name | (Z)-1-N-(4-fluoro-5-methylcyclohexa-1,5-dien-1-yl)-5-[[(Z)-2-fluoro-3-(propylamino)but-2-enylidene]amino]pent-1-ene-1,2-diamine |
| SMILES | CCCN/C(C)=C(F)/C=N/CCC/C(N)=C/NC1=CCC(F)C(C)=C1 |
| InChI | InChI=1S/C19H30F2N4/c1-4-9-24-15(3)19(21)13-23-10-5-6-16(22)12-25-17-7-8-18(20)14(2)11-17/h7,11-13,18,24-25H,4-6,8-10,22H2,1-3H3/b16-12-,19-15-,23-13+ |
| InChIKey | VZVJQPRZRKJIPQ-CXJRXUHOSA-N |
| XLogP | 4.00 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|