C16H16ClFN6O2 — CID 130321522
2-chloro-N-(fluoromethyl)-5-[4-[(1R)-1-(5-methoxypyrimidin-2-yl)oxyethyl]triazol-1-yl]aniline (PubChem CID 130321522) has the molecular formula C16H16ClFN6O2 and a molecular weight of 378.80 g/mol. Its IUPAC name is 2-chloro-N-(fluoromethyl)-5-[4-[(1R)-1-(5-methoxypyrimidin-2-yl)oxyethyl]triazol-1-yl]aniline.
| Compound Name | 2-chloro-N-(fluoromethyl)-5-[4-[(1R)-1-(5-methoxypyrimidin-2-yl)oxyethyl]triazol-1-yl]aniline |
|---|---|
| PubChem CID | 130321522 |
| Molecular Formula | C16H16ClFN6O2 |
| Molecular Weight | 378.80 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-chloro-N-(fluoromethyl)-5-[4-[(1R)-1-(5-methoxypyrimidin-2-yl)oxyethyl]triazol-1-yl]aniline |
| SMILES | COc1cnc(O[C@H](C)c2cn(-c3ccc(Cl)c(NCF)c3)nn2)nc1 |
| InChI | InChI=1S/C16H16ClFN6O2/c1-10(26-16-19-6-12(25-2)7-20-16)15-8-24(23-22-15)11-3-4-13(17)14(5-11)21-9-18/h3-8,10,21H,9H2,1-2H3/t10-/m1/s1 |
| InChIKey | UPMXVANIOZJLHB-SNVBAGLBSA-N |
| XLogP | 3.20 |
| TPSA | 86.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.80 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|