C8H8N2O2 — CID 130321653
1,5-dioxido-1,8a-dihydro-1,5-naphthyridine-1,5-diium (PubChem CID 130321653) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 1,5-dioxido-1,8a-dihydro-1,5-naphthyridine-1,5-diium.
| Compound Name | 1,5-dioxido-1,8a-dihydro-1,5-naphthyridine-1,5-diium |
|---|---|
| PubChem CID | 130321653 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 1,5-dioxido-1,8a-dihydro-1,5-naphthyridine-1,5-diium |
| SMILES | [O-][N+]1=CC=CC2C1=CC=C[NH+]2[O-] |
| InChI | InChI=1S/C8H8N2O2/c11-9-5-1-3-7-8(9)4-2-6-10(7)12/h1-7,10H |
| InChIKey | AZXNDYOEMJMTTO-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 53.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|