C11H12N4 — CID 130322168
3,5-dimethyl-1,5,7-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-amine (PubChem CID 130322168) has the molecular formula C11H12N4 and a molecular weight of 200.25 g/mol. Its IUPAC name is 3,5-dimethyl-1,5,7-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-amine.
| Compound Name | 3,5-dimethyl-1,5,7-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-amine |
|---|---|
| PubChem CID | 130322168 |
| Molecular Formula | C11H12N4 |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.11 |
| IUPAC Name | 3,5-dimethyl-1,5,7-triazatricyclo[6.4.0.02,6]dodeca-2(6),3,7,9,11-pentaen-4-amine |
| SMILES | Cc1c(N)n(C)c2nc3ccccn3c12 |
| InChI | InChI=1S/C11H12N4/c1-7-9-11(14(2)10(7)12)13-8-5-3-4-6-15(8)9/h3-6H,12H2,1-2H3 |
| InChIKey | NYJLEGNXRWMVHI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 48.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |