About 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine
1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine (PubChem CID 130322174) has the molecular formula C19H19N3
and a molecular weight of 289.38 g/mol. Its IUPAC name is 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine.
Molecular Properties
| Compound Name | 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine |
| PubChem CID | 130322174 |
| Molecular Formula | C19H19N3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine |
| SMILES | Cc1cccc(C)c1-n1c(N)c(C)c2cn3ccccc3c21 |
| InChI | InChI=1S/C19H19N3/c1-12-7-6-8-13(2)17(12)22-18-15(14(3)19(22)20)11-21-10-5-4-9-16(18)21/h4-11H,20H2,1-3H3 |
| InChIKey | WDDWPTMOEQLYMD-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 35.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine?
The IUPAC name of 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine (CID 130322174) is 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine.
What is the SMILES notation for 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine?
The canonical SMILES for 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine is Cc1cccc(C)c1-n1c(N)c(C)c2cn3ccccc3c21.
What is the InChIKey of 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine?
The InChIKey is WDDWPTMOEQLYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19N3/c1-12-7-6-8-13(2)17(12)22-18-15(14(3)19(22)20)11-21-10-5-4-9-16(18)21/h4-11H,20H2,1-3H3.
What are the key properties of 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine?
1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine has a molecular weight of 289.38 g/mol, XLogP of 4.39, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dimethylphenyl)-3-methylpyrrolo[2,3-a]indolizin-2-amine is sourced from PubChem (CID 130322174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).