About 2-iodo-3-methyl-3,4-dihydropyrazole
2-iodo-3-methyl-3,4-dihydropyrazole (PubChem CID 130322307) has the molecular formula C4H7IN2
and a molecular weight of 210.02 g/mol. Its IUPAC name is 2-iodo-3-methyl-3,4-dihydropyrazole.
Molecular Properties
| Compound Name | 2-iodo-3-methyl-3,4-dihydropyrazole |
| PubChem CID | 130322307 |
| Molecular Formula | C4H7IN2 |
| Molecular Weight | 210.02 g/mol |
| Exact Mass | 209.97 |
| IUPAC Name | 2-iodo-3-methyl-3,4-dihydropyrazole |
| SMILES | CC1CC=NN1I |
| InChI | InChI=1S/C4H7IN2/c1-4-2-3-6-7(4)5/h3-4H,2H2,1H3 |
| InChIKey | CQRZINQIUUHXBV-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.02 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-3-methyl-3,4-dihydropyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-3-methyl-3,4-dihydropyrazole?
The IUPAC name of 2-iodo-3-methyl-3,4-dihydropyrazole (CID 130322307) is 2-iodo-3-methyl-3,4-dihydropyrazole.
What is the SMILES notation for 2-iodo-3-methyl-3,4-dihydropyrazole?
The canonical SMILES for 2-iodo-3-methyl-3,4-dihydropyrazole is CC1CC=NN1I.
What is the InChIKey of 2-iodo-3-methyl-3,4-dihydropyrazole?
The InChIKey is CQRZINQIUUHXBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7IN2/c1-4-2-3-6-7(4)5/h3-4H,2H2,1H3.
What are the key properties of 2-iodo-3-methyl-3,4-dihydropyrazole?
2-iodo-3-methyl-3,4-dihydropyrazole has a molecular weight of 210.02 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-3-methyl-3,4-dihydropyrazole is sourced from PubChem (CID 130322307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).