About isoquinoline-1,3-diamine
isoquinoline-1,3-diamine (PubChem CID 13032237) has the molecular formula C9H9N3
and a molecular weight of 159.19 g/mol. Its IUPAC name is isoquinoline-1,3-diamine.
Molecular Properties
| Compound Name | isoquinoline-1,3-diamine |
| PubChem CID | 13032237 |
| Molecular Formula | C9H9N3 |
| Molecular Weight | 159.19 g/mol |
| Exact Mass | 159.08 |
| IUPAC Name | isoquinoline-1,3-diamine |
| SMILES | Nc1cc2ccccc2c(N)n1 |
| InChI | InChI=1S/C9H9N3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-5H,(H4,10,11,12) |
| InChIKey | RJDNVPUMVQGSJU-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.19 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze isoquinoline-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isoquinoline-1,3-diamine?
The IUPAC name of isoquinoline-1,3-diamine (CID 13032237) is isoquinoline-1,3-diamine.
What is the SMILES notation for isoquinoline-1,3-diamine?
The canonical SMILES for isoquinoline-1,3-diamine is Nc1cc2ccccc2c(N)n1.
What is the InChIKey of isoquinoline-1,3-diamine?
The InChIKey is RJDNVPUMVQGSJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-5H,(H4,10,11,12).
What are the key properties of isoquinoline-1,3-diamine?
isoquinoline-1,3-diamine has a molecular weight of 159.19 g/mol, XLogP of 1.40, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isoquinoline-1,3-diamine is sourced from PubChem (CID 13032237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).