C25H24ClFN4O3 — CID 130322555
(1R,3S,5S,6R)-2-[2-(3-acetylpyrrolo[2,3-c]pyridin-1-yl)acetyl]-N-[(3-chloro-2-fluorophenyl)methyl]-6-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 130322555) has the molecular formula C25H24ClFN4O3 and a molecular weight of 482.94 g/mol. Its IUPAC name is (1R,3S,5S,6R)-2-[2-(3-acetylpyrrolo[2,3-c]pyridin-1-yl)acetyl]-N-[(3-chloro-2-fluorophenyl)methyl]-6-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | (1R,3S,5S,6R)-2-[2-(3-acetylpyrrolo[2,3-c]pyridin-1-yl)acetyl]-N-[(3-chloro-2-fluorophenyl)methyl]-6-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 130322555 |
| Molecular Formula | C25H24ClFN4O3 |
| Molecular Weight | 482.94 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (1R,3S,5S,6R)-2-[2-(3-acetylpyrrolo[2,3-c]pyridin-1-yl)acetyl]-N-[(3-chloro-2-fluorophenyl)methyl]-6-methyl-2-azabicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | CC(=O)c1cn(CC(=O)N2[C@@H]3[C@H](C)[C@@H]3C[C@H]2C(=O)NCc2cccc(Cl)c2F)c2cnccc12 |
| InChI | InChI=1S/C25H24ClFN4O3/c1-13-17-8-20(25(34)29-9-15-4-3-5-19(26)23(15)27)31(24(13)17)22(33)12-30-11-18(14(2)32)16-6-7-28-10-21(16)30/h3-7,10-11,13,17,20,24H,8-9,12H2,1-2H3,(H,29,34)/t13-,17+,20+,24-/m1/s1 |
| InChIKey | DPDGESVBYKIHCI-LYGOGBJVSA-N |
| XLogP | 3.58 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.94 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |