About 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine
2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine (PubChem CID 130322601) has the molecular formula C11H11FN2
and a molecular weight of 190.22 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine |
| PubChem CID | 130322601 |
| Molecular Formula | C11H11FN2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine |
| SMILES | NC1=CCCC(c2ccccc2F)=N1 |
| InChI | InChI=1S/C11H11FN2/c12-9-5-2-1-4-8(9)10-6-3-7-11(13)14-10/h1-2,4-5,7H,3,6,13H2 |
| InChIKey | FGDSXPKXNLVFOJ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine?
The IUPAC name of 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine (CID 130322601) is 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine.
What is the SMILES notation for 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine?
The canonical SMILES for 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine is NC1=CCCC(c2ccccc2F)=N1.
What is the InChIKey of 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine?
The InChIKey is FGDSXPKXNLVFOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11FN2/c12-9-5-2-1-4-8(9)10-6-3-7-11(13)14-10/h1-2,4-5,7H,3,6,13H2.
What are the key properties of 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine?
2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine has a molecular weight of 190.22 g/mol, XLogP of 2.21, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)-3,4-dihydropyridin-6-amine is sourced from PubChem (CID 130322601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).