C9H12O4 — CID 13032271
3-acetyl-4-methoxy-5,5-dimethylfuran-2-one (PubChem CID 13032271) has the molecular formula C9H12O4 and a molecular weight of 184.19 g/mol. Its IUPAC name is 3-acetyl-4-methoxy-5,5-dimethylfuran-2-one.
| Compound Name | 3-acetyl-4-methoxy-5,5-dimethylfuran-2-one |
|---|---|
| PubChem CID | 13032271 |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 3-acetyl-4-methoxy-5,5-dimethylfuran-2-one |
| SMILES | COC1=C(C(C)=O)C(=O)OC1(C)C |
| InChI | InChI=1S/C9H12O4/c1-5(10)6-7(12-4)9(2,3)13-8(6)11/h1-4H3 |
| InChIKey | SAGIQUSGVQOZPZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|