C29H45IO3 — CID 130322812
(4aS,6aR,6aS,6bR,9S,14bS)-10-hydroxy-9-iodo-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid (PubChem CID 130322812) has the molecular formula C29H45IO3 and a molecular weight of 568.58 g/mol. Its IUPAC name is (4aS,6aR,6aS,6bR,9S,14bS)-10-hydroxy-9-iodo-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid.
| Compound Name | (4aS,6aR,6aS,6bR,9S,14bS)-10-hydroxy-9-iodo-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
|---|---|
| PubChem CID | 130322812 |
| Molecular Formula | C29H45IO3 |
| Molecular Weight | 568.58 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | (4aS,6aR,6aS,6bR,9S,14bS)-10-hydroxy-9-iodo-2,2,6a,6b,9,12a-hexamethyl-1,3,4,5,6,6a,7,8,8a,10,11,12,13,14b-tetradecahydropicene-4a-carboxylic acid |
| SMILES | CC1(C)CC[C@]2(C(=O)O)CC[C@]3(C)C(=CC[C@@H]4C5(C)CCC(O)[C@@](C)(I)C5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C29H45IO3/c1-24(2)13-15-29(23(32)33)16-14-26(4)18(19(29)17-24)7-8-20-25(3)11-10-22(31)28(6,30)21(25)9-12-27(20,26)5/h7,19-22,31H,8-17H2,1-6H3,(H,32,33)/t19-,20+,21?,22?,25?,26+,27+,28-,29-/m0/s1 |
| InChIKey | OEANUBOHWXAGMQ-DHQMWDCZSA-N |
| XLogP | 7.40 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.58 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|