About 6-methoxy-9-methylpurine
6-methoxy-9-methylpurine (PubChem CID 13032373) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 6-methoxy-9-methylpurine.
Molecular Properties
| Compound Name | 6-methoxy-9-methylpurine |
| PubChem CID | 13032373 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 6-methoxy-9-methylpurine |
| SMILES | COc1ncnc2c1ncn2C |
| InChI | InChI=1S/C7H8N4O/c1-11-4-10-5-6(11)8-3-9-7(5)12-2/h3-4H,1-2H3 |
| InChIKey | BJGMDJDZJGKXTG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-methoxy-9-methylpurine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxy-9-methylpurine?
The IUPAC name of 6-methoxy-9-methylpurine (CID 13032373) is 6-methoxy-9-methylpurine.
What is the SMILES notation for 6-methoxy-9-methylpurine?
The canonical SMILES for 6-methoxy-9-methylpurine is COc1ncnc2c1ncn2C.
What is the InChIKey of 6-methoxy-9-methylpurine?
The InChIKey is BJGMDJDZJGKXTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-11-4-10-5-6(11)8-3-9-7(5)12-2/h3-4H,1-2H3.
What are the key properties of 6-methoxy-9-methylpurine?
6-methoxy-9-methylpurine has a molecular weight of 164.17 g/mol, XLogP of 0.37, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxy-9-methylpurine is sourced from PubChem (CID 13032373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).