C28H22N2O7 — CID 130324440
(2R)-2-[[(E)-3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid (PubChem CID 130324440) has the molecular formula C28H22N2O7 and a molecular weight of 498.49 g/mol. Its IUPAC name is (2R)-2-[[(E)-3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid.
| Compound Name | (2R)-2-[[(E)-3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
|---|---|
| PubChem CID | 130324440 |
| Molecular Formula | C28H22N2O7 |
| Molecular Weight | 498.49 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | (2R)-2-[[(E)-3-[2-(3,4-dihydroxyphenyl)-7-hydroxy-1-benzofuran-4-yl]prop-2-enoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| SMILES | O=C(/C=C/c1ccc(O)c2oc(-c3ccc(O)c(O)c3)cc12)N[C@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C28H22N2O7/c31-22-8-6-16(12-24(22)33)25-13-19-15(5-9-23(32)27(19)37-25)7-10-26(34)30-21(28(35)36)11-17-14-29-20-4-2-1-3-18(17)20/h1-10,12-14,21,29,31-33H,11H2,(H,30,34)(H,35,36)/b10-7+/t21-/m1/s1 |
| InChIKey | LUPZSMMVHCJJEG-TYOLEZHBSA-N |
| XLogP | 4.52 |
| TPSA | 156.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.49 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|