About 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol
5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol (PubChem CID 130324534) has the molecular formula C13H18O2
and a molecular weight of 206.28 g/mol. Its IUPAC name is 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol.
Molecular Properties
| Compound Name | 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
| PubChem CID | 130324534 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.28 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol |
| SMILES | COc1c(C(C)C)ccc2c1C(C)(O)C2 |
| InChI | InChI=1S/C13H18O2/c1-8(2)10-6-5-9-7-13(3,14)11(9)12(10)15-4/h5-6,8,14H,7H2,1-4H3 |
| InChIKey | UWCKUIJOEHMKJJ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol?
The IUPAC name of 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol (CID 130324534) is 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol.
What is the SMILES notation for 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol?
The canonical SMILES for 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol is COc1c(C(C)C)ccc2c1C(C)(O)C2.
What is the InChIKey of 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol?
The InChIKey is UWCKUIJOEHMKJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-8(2)10-6-5-9-7-13(3,14)11(9)12(10)15-4/h5-6,8,14H,7H2,1-4H3.
What are the key properties of 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol?
5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol has a molecular weight of 206.28 g/mol, XLogP of 2.58, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-7-methyl-4-propan-2-ylbicyclo[4.2.0]octa-1(6),2,4-trien-7-ol is sourced from PubChem (CID 130324534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).