About (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine
(3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine (PubChem CID 130325526) has the molecular formula C11H19FN2
and a molecular weight of 198.28 g/mol. Its IUPAC name is (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine.
Molecular Properties
| Compound Name | (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine |
| PubChem CID | 130325526 |
| Molecular Formula | C11H19FN2 |
| Molecular Weight | 198.28 g/mol |
| Exact Mass | 198.15 |
| IUPAC Name | (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine |
| SMILES | C=C/C(=C(/CC)NCF)C1CCCN1 |
| InChI | InChI=1S/C11H19FN2/c1-3-9(10(4-2)14-8-12)11-6-5-7-13-11/h3,11,13-14H,1,4-8H2,2H3/b10-9+ |
| InChIKey | LHAPYQWAZPMWDN-MDZDMXLPSA-N |
| XLogP | 2.11 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine?
The IUPAC name of (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine (CID 130325526) is (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine.
What is the SMILES notation for (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine?
The canonical SMILES for (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine is C=C/C(=C(/CC)NCF)C1CCCN1.
What is the InChIKey of (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine?
The InChIKey is LHAPYQWAZPMWDN-MDZDMXLPSA-N. The full InChI is InChI=1S/C11H19FN2/c1-3-9(10(4-2)14-8-12)11-6-5-7-13-11/h3,11,13-14H,1,4-8H2,2H3/b10-9+.
What are the key properties of (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine?
(3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine has a molecular weight of 198.28 g/mol, XLogP of 2.11, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-N-(fluoromethyl)-4-pyrrolidin-2-ylhexa-3,5-dien-3-amine is sourced from PubChem (CID 130325526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).