About 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid
1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid (PubChem CID 13032587) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid |
| PubChem CID | 13032587 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid |
| SMILES | CN1CC=CC(C(=O)O)C1 |
| InChI | InChI=1S/C7H11NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-3,6H,4-5H2,1H3,(H,9,10) |
| InChIKey | CPZNNPFYSMLRIQ-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid?
The IUPAC name of 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid (CID 13032587) is 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid.
What is the SMILES notation for 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid?
The canonical SMILES for 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid is CN1CC=CC(C(=O)O)C1.
What is the InChIKey of 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid?
The InChIKey is CPZNNPFYSMLRIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-8-4-2-3-6(5-8)7(9)10/h2-3,6H,4-5H2,1H3,(H,9,10).
What are the key properties of 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid?
1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid has a molecular weight of 141.17 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3,6-dihydro-2H-pyridine-3-carboxylic acid is sourced from PubChem (CID 13032587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).