C13H17ClN2O — CID 130326984
2-chloro-8-ethyl-5,5,8-trimethyl-6H-1,6-naphthyridin-7-one (PubChem CID 130326984) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is 2-chloro-8-ethyl-5,5,8-trimethyl-6H-1,6-naphthyridin-7-one.
| Compound Name | 2-chloro-8-ethyl-5,5,8-trimethyl-6H-1,6-naphthyridin-7-one |
|---|---|
| PubChem CID | 130326984 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-chloro-8-ethyl-5,5,8-trimethyl-6H-1,6-naphthyridin-7-one |
| SMILES | CCC1(C)C(=O)NC(C)(C)c2ccc(Cl)nc21 |
| InChI | InChI=1S/C13H17ClN2O/c1-5-13(4)10-8(6-7-9(14)15-10)12(2,3)16-11(13)17/h6-7H,5H2,1-4H3,(H,16,17) |
| InChIKey | MSWLKXHZWRRMBZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|