C42H40F4N2O3S — CID 130327055
[(E)-[[11-(2-ethylhexyl)-5-(1-thiophen-2-ylethenyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate (PubChem CID 130327055) has the molecular formula C42H40F4N2O3S and a molecular weight of 728.85 g/mol. Its IUPAC name is [(E)-[[11-(2-ethylhexyl)-5-(1-thiophen-2-ylethenyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate.
| Compound Name | [(E)-[[11-(2-ethylhexyl)-5-(1-thiophen-2-ylethenyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
|---|---|
| PubChem CID | 130327055 |
| Molecular Formula | C42H40F4N2O3S |
| Molecular Weight | 728.85 g/mol |
| Exact Mass | 728.27 |
| IUPAC Name | [(E)-[[11-(2-ethylhexyl)-5-(1-thiophen-2-ylethenyl)benzo[a]carbazol-8-yl]-[2-(2,2,3,3-tetrafluoropropoxy)phenyl]methylidene]amino] acetate |
| SMILES | C=C(c1cccs1)c1cc2c3cc(/C(=N\OC(C)=O)c4ccccc4OCC(F)(F)C(F)F)ccc3n(CC(CC)CCCC)c2c2ccccc12 |
| InChI | InChI=1S/C42H40F4N2O3S/c1-5-7-13-28(6-2)24-48-36-20-19-29(39(47-51-27(4)49)32-16-10-11-17-37(32)50-25-42(45,46)41(43)44)22-34(36)35-23-33(26(3)38-18-12-21-52-38)30-14-8-9-15-31(30)40(35)48/h8-12,14-23,28,41H,3,5-7,13,24-25H2,1-2,4H3/b47-39+ |
| InChIKey | WMUFVYLUTQYPNN-XUVIPLOZSA-N |
| XLogP | 11.88 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.85 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|