About (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole
(4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole (PubChem CID 130327674) has the molecular formula C23H20FNO
and a molecular weight of 345.42 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole.
Molecular Properties
| Compound Name | (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole |
| PubChem CID | 130327674 |
| Molecular Formula | C23H20FNO |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole |
| SMILES | C[C@@]1(Cc2ccccc2)N=C(c2ccccc2)O[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C23H20FNO/c1-23(16-17-9-4-2-5-10-17)21(19-13-8-14-20(24)15-19)26-22(25-23)18-11-6-3-7-12-18/h2-15,21H,16H2,1H3/t21-,23-/m0/s1 |
| InChIKey | QIFGZAATJSPDKM-GMAHTHKFSA-N |
| XLogP | 5.35 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole?
The IUPAC name of (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole (CID 130327674) is (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole.
What is the SMILES notation for (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole?
The canonical SMILES for (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole is C[C@@]1(Cc2ccccc2)N=C(c2ccccc2)O[C@H]1c1cccc(F)c1.
What is the InChIKey of (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole?
The InChIKey is QIFGZAATJSPDKM-GMAHTHKFSA-N. The full InChI is InChI=1S/C23H20FNO/c1-23(16-17-9-4-2-5-10-17)21(19-13-8-14-20(24)15-19)26-22(25-23)18-11-6-3-7-12-18/h2-15,21H,16H2,1H3/t21-,23-/m0/s1.
What are the key properties of (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole?
(4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole has a molecular weight of 345.42 g/mol, XLogP of 5.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5S)-4-benzyl-5-(3-fluorophenyl)-4-methyl-2-phenyl-5H-1,3-oxazole is sourced from PubChem (CID 130327674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).