About methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate
methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate (PubChem CID 130327769) has the molecular formula C24H20FNO3
and a molecular weight of 389.43 g/mol. Its IUPAC name is methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate |
| PubChem CID | 130327769 |
| Molecular Formula | C24H20FNO3 |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate |
| SMILES | COC(=O)[C@@]1(Cc2ccccc2)N=C(c2ccccc2)O[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C24H20FNO3/c1-28-23(27)24(16-17-9-4-2-5-10-17)21(19-13-8-14-20(25)15-19)29-22(26-24)18-11-6-3-7-12-18/h2-15,21H,16H2,1H3/t21-,24-/m0/s1 |
| InChIKey | LPFNQALRBIKONU-URXFXBBRSA-N |
| XLogP | 4.50 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate?
The IUPAC name of methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate (CID 130327769) is methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate.
What is the SMILES notation for methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate?
The canonical SMILES for methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate is COC(=O)[C@@]1(Cc2ccccc2)N=C(c2ccccc2)O[C@H]1c1cccc(F)c1.
What is the InChIKey of methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate?
The InChIKey is LPFNQALRBIKONU-URXFXBBRSA-N. The full InChI is InChI=1S/C24H20FNO3/c1-28-23(27)24(16-17-9-4-2-5-10-17)21(19-13-8-14-20(25)15-19)29-22(26-24)18-11-6-3-7-12-18/h2-15,21H,16H2,1H3/t21-,24-/m0/s1.
What are the key properties of methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate?
methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate has a molecular weight of 389.43 g/mol, XLogP of 4.50, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S,5S)-4-benzyl-5-(3-fluorophenyl)-2-phenyl-5H-1,3-oxazole-4-carboxylate is sourced from PubChem (CID 130327769), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).