C14H14F7NO — CID 130328584
3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylanilino]propanal (PubChem CID 130328584) has the molecular formula C14H14F7NO and a molecular weight of 345.26 g/mol. Its IUPAC name is 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylanilino]propanal.
| Compound Name | 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylanilino]propanal |
|---|---|
| PubChem CID | 130328584 |
| Molecular Formula | C14H14F7NO |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 3-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-dimethylanilino]propanal |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)cc(C)c1NCCC=O |
| InChI | InChI=1S/C14H14F7NO/c1-8-6-10(7-9(2)11(8)22-4-3-5-23)12(15,13(16,17)18)14(19,20)21/h5-7,22H,3-4H2,1-2H3 |
| InChIKey | JNZXBABEJHVTPN-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|