C13H15Cl2N — CID 130328805
(3Z)-8-chloro-3-(1-chloroethylidene)-2,2-dimethylnona-5,6,8-trienenitrile (PubChem CID 130328805) has the molecular formula C13H15Cl2N and a molecular weight of 256.18 g/mol. Its IUPAC name is (3Z)-8-chloro-3-(1-chloroethylidene)-2,2-dimethylnona-5,6,8-trienenitrile.
| Compound Name | (3Z)-8-chloro-3-(1-chloroethylidene)-2,2-dimethylnona-5,6,8-trienenitrile |
|---|---|
| PubChem CID | 130328805 |
| Molecular Formula | C13H15Cl2N |
| Molecular Weight | 256.18 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (3Z)-8-chloro-3-(1-chloroethylidene)-2,2-dimethylnona-5,6,8-trienenitrile |
| SMILES | C=C(Cl)C=C=CC/C(=C(\C)Cl)C(C)(C)C#N |
| InChI | InChI=1S/C13H15Cl2N/c1-10(14)7-5-6-8-12(11(2)15)13(3,4)9-16/h6-7H,1,8H2,2-4H3/b12-11- |
| InChIKey | TYOBUDXSGJZCFO-QXMHVHEDSA-N |
| XLogP | 4.90 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.18 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|