About 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one
1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one (PubChem CID 130328885) has the molecular formula C12H18O
and a molecular weight of 178.27 g/mol. Its IUPAC name is 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one.
Molecular Properties
| Compound Name | 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one |
| PubChem CID | 130328885 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one |
| SMILES | CCC(=O)C1CC2CCC1C1CC21 |
| InChI | InChI=1S/C12H18O/c1-2-12(13)11-5-7-3-4-8(11)10-6-9(7)10/h7-11H,2-6H2,1H3 |
| InChIKey | NUGLSRQCRNVXDP-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one?
The IUPAC name of 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one (CID 130328885) is 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one.
What is the SMILES notation for 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one?
The canonical SMILES for 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one is CCC(=O)C1CC2CCC1C1CC21.
What is the InChIKey of 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one?
The InChIKey is NUGLSRQCRNVXDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O/c1-2-12(13)11-5-7-3-4-8(11)10-6-9(7)10/h7-11H,2-6H2,1H3.
What are the key properties of 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one?
1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one has a molecular weight of 178.27 g/mol, XLogP of 2.65, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-tricyclo[3.2.2.02,4]nonanyl)propan-1-one is sourced from PubChem (CID 130328885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).