C13H22F2N2 — CID 130329197
(2E,4Z,6E)-6-N-(2,2-difluoropropyl)-3-N-methylnona-2,4,6-triene-3,6-diamine (PubChem CID 130329197) has the molecular formula C13H22F2N2 and a molecular weight of 244.33 g/mol. Its IUPAC name is (2E,4Z,6E)-6-N-(2,2-difluoropropyl)-3-N-methylnona-2,4,6-triene-3,6-diamine.
| Compound Name | (2E,4Z,6E)-6-N-(2,2-difluoropropyl)-3-N-methylnona-2,4,6-triene-3,6-diamine |
|---|---|
| PubChem CID | 130329197 |
| Molecular Formula | C13H22F2N2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (2E,4Z,6E)-6-N-(2,2-difluoropropyl)-3-N-methylnona-2,4,6-triene-3,6-diamine |
| SMILES | C/C=C(\C=C/C(=C\CC)NCC(C)(F)F)NC |
| InChI | InChI=1S/C13H22F2N2/c1-5-7-12(17-10-13(3,14)15)9-8-11(6-2)16-4/h6-9,16-17H,5,10H2,1-4H3/b9-8-,11-6+,12-7+ |
| InChIKey | WIKPJUGNJUGJDN-WPCHRYQWSA-N |
| XLogP | 3.20 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|