C11H15N3 — CID 130329270
(1Z,3Z,5E)-2-methanimidoyl-3-[(Z)-2-(methylideneamino)ethenyl]hepta-1,3,5-trien-1-amine (PubChem CID 130329270) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is (1Z,3Z,5E)-2-methanimidoyl-3-[(Z)-2-(methylideneamino)ethenyl]hepta-1,3,5-trien-1-amine.
| Compound Name | (1Z,3Z,5E)-2-methanimidoyl-3-[(Z)-2-(methylideneamino)ethenyl]hepta-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 130329270 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | (1Z,3Z,5E)-2-methanimidoyl-3-[(Z)-2-(methylideneamino)ethenyl]hepta-1,3,5-trien-1-amine |
| SMILES | [H]/N=C/C(=C\N)C(/C=C\N=C)=C\C=C\C |
| InChI | InChI=1S/C11H15N3/c1-3-4-5-10(6-7-14-2)11(8-12)9-13/h3-9,12H,2,13H2,1H3/b4-3+,7-6-,10-5-,11-9+,12-8+ |
| InChIKey | KZYMLGHVVALSLR-PLXLLGNGSA-N |
| XLogP | 2.20 |
| TPSA | 62.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|