About 2,4,5-trimethyl-7H-1,4-thiazepine
2,4,5-trimethyl-7H-1,4-thiazepine (PubChem CID 130329957) has the molecular formula C8H13NS
and a molecular weight of 155.27 g/mol. Its IUPAC name is 2,4,5-trimethyl-7H-1,4-thiazepine.
Molecular Properties
| Compound Name | 2,4,5-trimethyl-7H-1,4-thiazepine |
| PubChem CID | 130329957 |
| Molecular Formula | C8H13NS |
| Molecular Weight | 155.27 g/mol |
| Exact Mass | 155.08 |
| IUPAC Name | 2,4,5-trimethyl-7H-1,4-thiazepine |
| SMILES | CC1=CN(C)C(C)=CCS1 |
| InChI | InChI=1S/C8H13NS/c1-7-4-5-10-8(2)6-9(7)3/h4,6H,5H2,1-3H3 |
| InChIKey | UZKGRLOONCQKCS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4,5-trimethyl-7H-1,4-thiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,5-trimethyl-7H-1,4-thiazepine?
The IUPAC name of 2,4,5-trimethyl-7H-1,4-thiazepine (CID 130329957) is 2,4,5-trimethyl-7H-1,4-thiazepine.
What is the SMILES notation for 2,4,5-trimethyl-7H-1,4-thiazepine?
The canonical SMILES for 2,4,5-trimethyl-7H-1,4-thiazepine is CC1=CN(C)C(C)=CCS1.
What is the InChIKey of 2,4,5-trimethyl-7H-1,4-thiazepine?
The InChIKey is UZKGRLOONCQKCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NS/c1-7-4-5-10-8(2)6-9(7)3/h4,6H,5H2,1-3H3.
What are the key properties of 2,4,5-trimethyl-7H-1,4-thiazepine?
2,4,5-trimethyl-7H-1,4-thiazepine has a molecular weight of 155.27 g/mol, XLogP of 2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,5-trimethyl-7H-1,4-thiazepine is sourced from PubChem (CID 130329957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).