C25H20FN5O2 — CID 130330053
N'-[4-[[4-(2-cyano-6-fluorophenoxy)-3-oxo-1H-isoindol-2-yl]methyl]-N-methylanilino]-N-methylidenemethanimidamide (PubChem CID 130330053) has the molecular formula C25H20FN5O2 and a molecular weight of 441.47 g/mol. Its IUPAC name is N'-[4-[[4-(2-cyano-6-fluorophenoxy)-3-oxo-1H-isoindol-2-yl]methyl]-N-methylanilino]-N-methylidenemethanimidamide.
| Compound Name | N'-[4-[[4-(2-cyano-6-fluorophenoxy)-3-oxo-1H-isoindol-2-yl]methyl]-N-methylanilino]-N-methylidenemethanimidamide |
|---|---|
| PubChem CID | 130330053 |
| Molecular Formula | C25H20FN5O2 |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | N'-[4-[[4-(2-cyano-6-fluorophenoxy)-3-oxo-1H-isoindol-2-yl]methyl]-N-methylanilino]-N-methylidenemethanimidamide |
| SMILES | C=N/C=N\N(C)c1ccc(CN2Cc3cccc(Oc4c(F)cccc4C#N)c3C2=O)cc1 |
| InChI | InChI=1S/C25H20FN5O2/c1-28-16-29-30(2)20-11-9-17(10-12-20)14-31-15-19-6-4-8-22(23(19)25(31)32)33-24-18(13-27)5-3-7-21(24)26/h3-12,16H,1,14-15H2,2H3/b29-16- |
| InChIKey | JURJWWOWNZMGME-MWLSYYOVSA-N |
| XLogP | 4.73 |
| TPSA | 81.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|