C10H17NO — CID 130330265
(2Z,4E)-4-(methoxymethyl)-N-methylhepta-2,4,6-trien-1-amine (PubChem CID 130330265) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is (2Z,4E)-4-(methoxymethyl)-N-methylhepta-2,4,6-trien-1-amine.
| Compound Name | (2Z,4E)-4-(methoxymethyl)-N-methylhepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 130330265 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (2Z,4E)-4-(methoxymethyl)-N-methylhepta-2,4,6-trien-1-amine |
| SMILES | C=C/C=C(\C=C/CNC)COC |
| InChI | InChI=1S/C10H17NO/c1-4-6-10(9-12-3)7-5-8-11-2/h4-7,11H,1,8-9H2,2-3H3/b7-5-,10-6+ |
| InChIKey | SKOSUYOYZJSYPG-ZPRNNRRZSA-N |
| XLogP | 1.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|