C9H12N4O3 — CID 130330274
4-amino-1-(6-hydroxy-4-oxa-1-azaspiro[2.4]heptan-5-yl)pyrimidin-2-one (PubChem CID 130330274) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is 4-amino-1-(6-hydroxy-4-oxa-1-azaspiro[2.4]heptan-5-yl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(6-hydroxy-4-oxa-1-azaspiro[2.4]heptan-5-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 130330274 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 4-amino-1-(6-hydroxy-4-oxa-1-azaspiro[2.4]heptan-5-yl)pyrimidin-2-one |
| SMILES | Nc1ccn(C2OC3(CN3)CC2O)c(=O)n1 |
| InChI | InChI=1S/C9H12N4O3/c10-6-1-2-13(8(15)12-6)7-5(14)3-9(16-7)4-11-9/h1-2,5,7,11,14H,3-4H2,(H2,10,12,15) |
| InChIKey | FPLNZCSGGWXHKH-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 112.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|