C19H29NO2 — CID 130330384
2-[[(2S)-1-hydroxy-4-methylpentan-2-yl]amino]-1-(1-phenylcyclopentyl)ethanone (PubChem CID 130330384) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is 2-[[(2S)-1-hydroxy-4-methylpentan-2-yl]amino]-1-(1-phenylcyclopentyl)ethanone.
| Compound Name | 2-[[(2S)-1-hydroxy-4-methylpentan-2-yl]amino]-1-(1-phenylcyclopentyl)ethanone |
|---|---|
| PubChem CID | 130330384 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | 2-[[(2S)-1-hydroxy-4-methylpentan-2-yl]amino]-1-(1-phenylcyclopentyl)ethanone |
| SMILES | CC(C)C[C@@H](CO)NCC(=O)C1(c2ccccc2)CCCC1 |
| InChI | InChI=1S/C19H29NO2/c1-15(2)12-17(14-21)20-13-18(22)19(10-6-7-11-19)16-8-4-3-5-9-16/h3-5,8-9,15,17,20-21H,6-7,10-14H2,1-2H3/t17-/m0/s1 |
| InChIKey | APKQTEOILSHVSF-KRWDZBQOSA-N |
| XLogP | 3.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |