C25H22BrF5N2O7 — CID 130330538
4-O-[2-[(2Z,4Z,6Z)-8-amino-2,6-difluoro-8-oxoocta-2,4,6-trien-3-yl]oxy-2-[5-bromo-4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]ethyl] 1-O-methyl butanedioate (PubChem CID 130330538) has the molecular formula C25H22BrF5N2O7 and a molecular weight of 637.35 g/mol. Its IUPAC name is 4-O-[2-[(2Z,4Z,6Z)-8-amino-2,6-difluoro-8-oxoocta-2,4,6-trien-3-yl]oxy-2-[5-bromo-4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]ethyl] 1-O-methyl butanedioate.
| Compound Name | 4-O-[2-[(2Z,4Z,6Z)-8-amino-2,6-difluoro-8-oxoocta-2,4,6-trien-3-yl]oxy-2-[5-bromo-4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]ethyl] 1-O-methyl butanedioate |
|---|---|
| PubChem CID | 130330538 |
| Molecular Formula | C25H22BrF5N2O7 |
| Molecular Weight | 637.35 g/mol |
| Exact Mass | 636.05 |
| IUPAC Name | 4-O-[2-[(2Z,4Z,6Z)-8-amino-2,6-difluoro-8-oxoocta-2,4,6-trien-3-yl]oxy-2-[5-bromo-4-[4-(trifluoromethyl)phenyl]-1,3-oxazol-2-yl]ethyl] 1-O-methyl butanedioate |
| SMILES | COC(=O)CCC(=O)OCC(OC(/C=C\C(F)=C\C(N)=O)=C(/C)F)c1nc(-c2ccc(C(F)(F)F)cc2)c(Br)o1 |
| InChI | InChI=1S/C25H22BrF5N2O7/c1-13(27)17(8-7-16(28)11-19(32)34)39-18(12-38-21(36)10-9-20(35)37-2)24-33-22(23(26)40-24)14-3-5-15(6-4-14)25(29,30)31/h3-8,11,18H,9-10,12H2,1-2H3,(H2,32,34)/b8-7-,16-11-,17-13- |
| InChIKey | NMXPKPWOIHKKHE-NQRKXCCQSA-N |
| XLogP | 5.77 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.35 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|