C24H21F5N2O2 — CID 130330740
(E)-3-[4-[2-(2,2-difluoropropyl)-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid (PubChem CID 130330740) has the molecular formula C24H21F5N2O2 and a molecular weight of 464.43 g/mol. Its IUPAC name is (E)-3-[4-[2-(2,2-difluoropropyl)-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[2-(2,2-difluoropropyl)-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 130330740 |
| Molecular Formula | C24H21F5N2O2 |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | (E)-3-[4-[2-(2,2-difluoropropyl)-6-fluoro-3-methyl-1,3,4,9-tetrahydropyrido[3,4-b]indol-1-yl]-3,5-difluorophenyl]prop-2-enoic acid |
| SMILES | CC1Cc2c([nH]c3ccc(F)cc23)C(c2c(F)cc(/C=C/C(=O)O)cc2F)N1CC(C)(F)F |
| InChI | InChI=1S/C24H21F5N2O2/c1-12-7-16-15-10-14(25)4-5-19(15)30-22(16)23(31(12)11-24(2,28)29)21-17(26)8-13(9-18(21)27)3-6-20(32)33/h3-6,8-10,12,23,30H,7,11H2,1-2H3,(H,32,33)/b6-3+ |
| InChIKey | OQKDEIVFDYQOAP-ZZXKWVIFSA-N |
| XLogP | 5.67 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|