About 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine
5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine (PubChem CID 130330788) has the molecular formula C12H16FN4S+
and a molecular weight of 267.35 g/mol. Its IUPAC name is 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine |
| PubChem CID | 130330788 |
| Molecular Formula | C12H16FN4S+ |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine |
| SMILES | CCc1sc[n+](Cc2cnc(C)nc2NF)c1C |
| InChI | InChI=1S/C12H16FN4S/c1-4-11-8(2)17(7-18-11)6-10-5-14-9(3)15-12(10)16-13/h5,7H,4,6H2,1-3H3,(H,14,15,16)/q+1 |
| InChIKey | OLQDCQNPOSNWAZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 41.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine?
The IUPAC name of 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine (CID 130330788) is 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine.
What is the SMILES notation for 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine?
The canonical SMILES for 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine is CCc1sc[n+](Cc2cnc(C)nc2NF)c1C.
What is the InChIKey of 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine?
The InChIKey is OLQDCQNPOSNWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16FN4S/c1-4-11-8(2)17(7-18-11)6-10-5-14-9(3)15-12(10)16-13/h5,7H,4,6H2,1-3H3,(H,14,15,16)/q+1.
What are the key properties of 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine?
5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine has a molecular weight of 267.35 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-N-fluoro-2-methylpyrimidin-4-amine is sourced from PubChem (CID 130330788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).