C16H22FN — CID 130331104
3-(4-fluorophenyl)-8-propan-2-yl-8-azabicyclo[3.2.1]octane (PubChem CID 130331104) has the molecular formula C16H22FN and a molecular weight of 247.36 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-8-propan-2-yl-8-azabicyclo[3.2.1]octane.
| Compound Name | 3-(4-fluorophenyl)-8-propan-2-yl-8-azabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 130331104 |
| Molecular Formula | C16H22FN |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.17 |
| IUPAC Name | 3-(4-fluorophenyl)-8-propan-2-yl-8-azabicyclo[3.2.1]octane |
| SMILES | CC(C)N1C2CCC1CC(c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C16H22FN/c1-11(2)18-15-7-8-16(18)10-13(9-15)12-3-5-14(17)6-4-12/h3-6,11,13,15-16H,7-10H2,1-2H3 |
| InChIKey | HEBVWVQDIFNIND-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |