About 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate
2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate (PubChem CID 130331394) has the molecular formula C17H22ClFN2O4
and a molecular weight of 372.82 g/mol. Its IUPAC name is 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate.
Molecular Properties
| Compound Name | 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate |
| PubChem CID | 130331394 |
| Molecular Formula | C17H22ClFN2O4 |
| Molecular Weight | 372.82 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate |
| SMILES | CCC(C(=O)NC1(c2ncc(Cl)cc2F)COC1)C(=O)OCC(C)C |
| InChI | InChI=1S/C17H22ClFN2O4/c1-4-12(16(23)25-7-10(2)3)15(22)21-17(8-24-9-17)14-13(19)5-11(18)6-20-14/h5-6,10,12H,4,7-9H2,1-3H3,(H,21,22) |
| InChIKey | KTZICBOLWAOAJH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.82 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate?
The IUPAC name of 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate (CID 130331394) is 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate.
What is the SMILES notation for 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate?
The canonical SMILES for 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate is CCC(C(=O)NC1(c2ncc(Cl)cc2F)COC1)C(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate?
The InChIKey is KTZICBOLWAOAJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22ClFN2O4/c1-4-12(16(23)25-7-10(2)3)15(22)21-17(8-24-9-17)14-13(19)5-11(18)6-20-14/h5-6,10,12H,4,7-9H2,1-3H3,(H,21,22).
What are the key properties of 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate?
2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate has a molecular weight of 372.82 g/mol, XLogP of 2.44, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl 2-[[3-(5-chloro-3-fluoro-2-pyridinyl)oxetan-3-yl]carbamoyl]butanoate is sourced from PubChem (CID 130331394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).