C11H15FN2 — CID 130331428
N-[(1E,3Z)-2-fluoro-1-(1,2,3,6-tetrahydropyridin-4-yl)penta-1,3-dienyl]methanimine (PubChem CID 130331428) has the molecular formula C11H15FN2 and a molecular weight of 194.25 g/mol. Its IUPAC name is N-[(1E,3Z)-2-fluoro-1-(1,2,3,6-tetrahydropyridin-4-yl)penta-1,3-dienyl]methanimine.
| Compound Name | N-[(1E,3Z)-2-fluoro-1-(1,2,3,6-tetrahydropyridin-4-yl)penta-1,3-dienyl]methanimine |
|---|---|
| PubChem CID | 130331428 |
| Molecular Formula | C11H15FN2 |
| Molecular Weight | 194.25 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | N-[(1E,3Z)-2-fluoro-1-(1,2,3,6-tetrahydropyridin-4-yl)penta-1,3-dienyl]methanimine |
| SMILES | C=N/C(C1=CCNCC1)=C(F)\C=C/C |
| InChI | InChI=1S/C11H15FN2/c1-3-4-10(12)11(13-2)9-5-7-14-8-6-9/h3-5,14H,2,6-8H2,1H3/b4-3-,11-10+ |
| InChIKey | KKCAKRKAJVLARI-CSWDMDPZSA-N |
| XLogP | 2.36 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.25 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|