About 5-methyl-1,2-oxazol-4-amine
5-methyl-1,2-oxazol-4-amine (PubChem CID 13033202) has the molecular formula C4H6N2O
and a molecular weight of 98.10 g/mol. Its IUPAC name is 5-methyl-1,2-oxazol-4-amine.
Molecular Properties
| Compound Name | 5-methyl-1,2-oxazol-4-amine |
| PubChem CID | 13033202 |
| Molecular Formula | C4H6N2O |
| Molecular Weight | 98.10 g/mol |
| Exact Mass | 98.05 |
| IUPAC Name | 5-methyl-1,2-oxazol-4-amine |
| SMILES | Cc1oncc1N |
| InChI | InChI=1S/C4H6N2O/c1-3-4(5)2-6-7-3/h2H,5H2,1H3 |
| InChIKey | QGMHRTDVNDXDBB-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.10 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-1,2-oxazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-1,2-oxazol-4-amine?
The IUPAC name of 5-methyl-1,2-oxazol-4-amine (CID 13033202) is 5-methyl-1,2-oxazol-4-amine.
What is the SMILES notation for 5-methyl-1,2-oxazol-4-amine?
The canonical SMILES for 5-methyl-1,2-oxazol-4-amine is Cc1oncc1N.
What is the InChIKey of 5-methyl-1,2-oxazol-4-amine?
The InChIKey is QGMHRTDVNDXDBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O/c1-3-4(5)2-6-7-3/h2H,5H2,1H3.
What are the key properties of 5-methyl-1,2-oxazol-4-amine?
5-methyl-1,2-oxazol-4-amine has a molecular weight of 98.10 g/mol, XLogP of 0.57, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,2-oxazol-4-amine is sourced from PubChem (CID 13033202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).