About thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate
thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate (PubChem CID 130332193) has the molecular formula C16H14ClN3O3S
and a molecular weight of 363.83 g/mol. Its IUPAC name is thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate.
Molecular Properties
| Compound Name | thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate |
| PubChem CID | 130332193 |
| Molecular Formula | C16H14ClN3O3S |
| Molecular Weight | 363.83 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate |
| SMILES | CC(C)Oc1ccc(Cl)cc1NC(=O)Oc1csc2cncnc12 |
| InChI | InChI=1S/C16H14ClN3O3S/c1-9(2)22-12-4-3-10(17)5-11(12)20-16(21)23-13-7-24-14-6-18-8-19-15(13)14/h3-9H,1-2H3,(H,20,21) |
| InChIKey | LEYZPIKKLYOSLL-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.83 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate?
The IUPAC name of thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate (CID 130332193) is thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate.
What is the SMILES notation for thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate?
The canonical SMILES for thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate is CC(C)Oc1ccc(Cl)cc1NC(=O)Oc1csc2cncnc12.
What is the InChIKey of thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate?
The InChIKey is LEYZPIKKLYOSLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14ClN3O3S/c1-9(2)22-12-4-3-10(17)5-11(12)20-16(21)23-13-7-24-14-6-18-8-19-15(13)14/h3-9H,1-2H3,(H,20,21).
What are the key properties of thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate?
thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate has a molecular weight of 363.83 g/mol, XLogP of 4.74, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for thieno[3,2-d]pyrimidin-7-yl N-(5-chloro-2-propan-2-yloxyphenyl)carbamate is sourced from PubChem (CID 130332193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).