C22H22ClFN4OS — CID 130332572
N-[(5-chloro-2-methoxy-3-pyridinyl)sulfanyl]-2-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]pyridin-4-amine (PubChem CID 130332572) has the molecular formula C22H22ClFN4OS and a molecular weight of 444.96 g/mol. Its IUPAC name is N-[(5-chloro-2-methoxy-3-pyridinyl)sulfanyl]-2-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]pyridin-4-amine.
| Compound Name | N-[(5-chloro-2-methoxy-3-pyridinyl)sulfanyl]-2-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]pyridin-4-amine |
|---|---|
| PubChem CID | 130332572 |
| Molecular Formula | C22H22ClFN4OS |
| Molecular Weight | 444.96 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-[(5-chloro-2-methoxy-3-pyridinyl)sulfanyl]-2-[3-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]pyridin-4-amine |
| SMILES | COc1ncc(Cl)cc1SNc1ccnc(-c2ccc(CN3CCCC3)c(F)c2)c1 |
| InChI | InChI=1S/C22H22ClFN4OS/c1-29-22-21(11-17(23)13-26-22)30-27-18-6-7-25-20(12-18)15-4-5-16(19(24)10-15)14-28-8-2-3-9-28/h4-7,10-13H,2-3,8-9,14H2,1H3,(H,25,27) |
| InChIKey | SRQHUBVDKMJGKE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.96 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|