C26H30FN5O2S — CID 130332573
2-[2-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]-N-[(2-methoxy-5-morpholin-4-yl-3-pyridinyl)sulfanyl]pyridin-4-amine (PubChem CID 130332573) has the molecular formula C26H30FN5O2S and a molecular weight of 495.62 g/mol. Its IUPAC name is 2-[2-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]-N-[(2-methoxy-5-morpholin-4-yl-3-pyridinyl)sulfanyl]pyridin-4-amine.
| Compound Name | 2-[2-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]-N-[(2-methoxy-5-morpholin-4-yl-3-pyridinyl)sulfanyl]pyridin-4-amine |
|---|---|
| PubChem CID | 130332573 |
| Molecular Formula | C26H30FN5O2S |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 2-[2-fluoro-4-(pyrrolidin-1-ylmethyl)phenyl]-N-[(2-methoxy-5-morpholin-4-yl-3-pyridinyl)sulfanyl]pyridin-4-amine |
| SMILES | COc1ncc(N2CCOCC2)cc1SNc1ccnc(-c2ccc(CN3CCCC3)cc2F)c1 |
| InChI | InChI=1S/C26H30FN5O2S/c1-33-26-25(16-21(17-29-26)32-10-12-34-13-11-32)35-30-20-6-7-28-24(15-20)22-5-4-19(14-23(22)27)18-31-8-2-3-9-31/h4-7,14-17H,2-3,8-13,18H2,1H3,(H,28,30) |
| InChIKey | KTZQAHBWUPZOMY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|