About pyrazin-2-ylurea
pyrazin-2-ylurea (PubChem CID 13033268) has the molecular formula C5H6N4O
and a molecular weight of 138.13 g/mol. Its IUPAC name is pyrazin-2-ylurea.
Molecular Properties
| Compound Name | pyrazin-2-ylurea |
| PubChem CID | 13033268 |
| Molecular Formula | C5H6N4O |
| Molecular Weight | 138.13 g/mol |
| Exact Mass | 138.05 |
| IUPAC Name | pyrazin-2-ylurea |
| SMILES | NC(=O)Nc1cnccn1 |
| InChI | InChI=1S/C5H6N4O/c6-5(10)9-4-3-7-1-2-8-4/h1-3H,(H3,6,8,9,10) |
| InChIKey | VRJZAXSEHHYIMD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.13 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrazin-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrazin-2-ylurea?
The IUPAC name of pyrazin-2-ylurea (CID 13033268) is pyrazin-2-ylurea.
What is the SMILES notation for pyrazin-2-ylurea?
The canonical SMILES for pyrazin-2-ylurea is NC(=O)Nc1cnccn1.
What is the InChIKey of pyrazin-2-ylurea?
The InChIKey is VRJZAXSEHHYIMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4O/c6-5(10)9-4-3-7-1-2-8-4/h1-3H,(H3,6,8,9,10).
What are the key properties of pyrazin-2-ylurea?
pyrazin-2-ylurea has a molecular weight of 138.13 g/mol, XLogP of -0.03, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrazin-2-ylurea is sourced from PubChem (CID 13033268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).