C6F12 — CID 13033398
(E)-1,1,1,2,4,4,5,5,5-nonafluoro-3-(trifluoromethyl)pent-2-ene (PubChem CID 13033398) has the molecular formula C6F12 and a molecular weight of 300.04 g/mol. Its IUPAC name is (E)-1,1,1,2,4,4,5,5,5-nonafluoro-3-(trifluoromethyl)pent-2-ene.
| Compound Name | (E)-1,1,1,2,4,4,5,5,5-nonafluoro-3-(trifluoromethyl)pent-2-ene |
|---|---|
| PubChem CID | 13033398 |
| Molecular Formula | C6F12 |
| Molecular Weight | 300.04 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | (E)-1,1,1,2,4,4,5,5,5-nonafluoro-3-(trifluoromethyl)pent-2-ene |
| SMILES | F/C(=C(/C(F)(F)F)C(F)(F)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6F12/c7-2(5(13,14)15)1(4(10,11)12)3(8,9)6(16,17)18/b2-1+ |
| InChIKey | CPRVHLZOPXZTJR-OWOJBTEDSA-N |
| XLogP | 4.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.04 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|