C8H12I2 — CID 130334705
2,5-diiodo-1,2,3,3a,4,5,6,6a-octahydropentalene (PubChem CID 130334705) has the molecular formula C8H12I2 and a molecular weight of 361.99 g/mol. Its IUPAC name is 2,5-diiodo-1,2,3,3a,4,5,6,6a-octahydropentalene.
| Compound Name | 2,5-diiodo-1,2,3,3a,4,5,6,6a-octahydropentalene |
|---|---|
| PubChem CID | 130334705 |
| Molecular Formula | C8H12I2 |
| Molecular Weight | 361.99 g/mol |
| Exact Mass | 361.90 |
| IUPAC Name | 2,5-diiodo-1,2,3,3a,4,5,6,6a-octahydropentalene |
| SMILES | IC1CC2CC(I)CC2C1 |
| InChI | InChI=1S/C8H12I2/c9-7-1-5-2-8(10)4-6(5)3-7/h5-8H,1-4H2 |
| InChIKey | IZLMCQUJVAWZNB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.99 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|