C16H28N2 — CID 130334737
N-methyl-N'-[(4Z,6Z)-5,6,7-trimethylnona-1,4,6,8-tetraen-2-yl]propane-1,3-diamine (PubChem CID 130334737) has the molecular formula C16H28N2 and a molecular weight of 248.41 g/mol. Its IUPAC name is N-methyl-N'-[(4Z,6Z)-5,6,7-trimethylnona-1,4,6,8-tetraen-2-yl]propane-1,3-diamine.
| Compound Name | N-methyl-N'-[(4Z,6Z)-5,6,7-trimethylnona-1,4,6,8-tetraen-2-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 130334737 |
| Molecular Formula | C16H28N2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.23 |
| IUPAC Name | N-methyl-N'-[(4Z,6Z)-5,6,7-trimethylnona-1,4,6,8-tetraen-2-yl]propane-1,3-diamine |
| SMILES | C=C/C(C)=C(C)\C(C)=C/CC(=C)NCCCNC |
| InChI | InChI=1S/C16H28N2/c1-7-13(2)16(5)14(3)9-10-15(4)18-12-8-11-17-6/h7,9,17-18H,1,4,8,10-12H2,2-3,5-6H3/b14-9-,16-13- |
| InChIKey | JNKZMTDXZBIITC-ZFNUHOEMSA-N |
| XLogP | 3.56 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|