C26H21F6N7O6 — CID 130335020
[(3aS,4S,9S,10aS)-2,6-diamino-4-[(1,3-dioxoisoindol-2-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate (PubChem CID 130335020) has the molecular formula C26H21F6N7O6 and a molecular weight of 641.49 g/mol. Its IUPAC name is [(3aS,4S,9S,10aS)-2,6-diamino-4-[(1,3-dioxoisoindol-2-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-[(1,3-dioxoisoindol-2-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 130335020 |
| Molecular Formula | C26H21F6N7O6 |
| Molecular Weight | 641.49 g/mol |
| Exact Mass | 641.15 |
| IUPAC Name | [(3aS,4S,9S,10aS)-2,6-diamino-4-[(1,3-dioxoisoindol-2-yl)methyl]-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate |
| SMILES | NC1=N[C@H]2[C@H](CN3C(=O)c4ccccc4C3=O)N=C(N)N3C[C@H](OC(=O)c4cc(C(F)(F)F)ccc4C(F)(F)F)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C26H21F6N7O6/c27-25(28,29)10-5-6-14(26(30,31)32)13(7-10)20(42)45-16-9-39-22(34)35-15(17-23(39,24(16,43)44)37-21(33)36-17)8-38-18(40)11-3-1-2-4-12(11)19(38)41/h1-7,15-17,43-44H,8-9H2,(H2,34,35)(H3,33,36,37)/t15-,16-,17-,23-/m0/s1 |
| InChIKey | BTRGMJDPUSNCAR-DSFVOBFGSA-N |
| XLogP | 0.22 |
| TPSA | 196.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.49 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|